C27H34F3N3O4 — CID 147354750
[4,4,4-trifluoro-2-[(2-pyridin-3-yl-1-benzofuran-6-yl)oxymethyl]butyl] 3,5-diamino-2,2,5-trimethylhexanoate (PubChem CID 147354750) has the molecular formula C27H34F3N3O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[(2-pyridin-3-yl-1-benzofuran-6-yl)oxymethyl]butyl] 3,5-diamino-2,2,5-trimethylhexanoate.
| Compound Name | [4,4,4-trifluoro-2-[(2-pyridin-3-yl-1-benzofuran-6-yl)oxymethyl]butyl] 3,5-diamino-2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 147354750 |
| Molecular Formula | C27H34F3N3O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | [4,4,4-trifluoro-2-[(2-pyridin-3-yl-1-benzofuran-6-yl)oxymethyl]butyl] 3,5-diamino-2,2,5-trimethylhexanoate |
| SMILES | CC(C)(N)CC(N)C(C)(C)C(=O)OCC(COc1ccc2cc(-c3cccnc3)oc2c1)CC(F)(F)F |
| InChI | InChI=1S/C27H34F3N3O4/c1-25(2,32)13-23(31)26(3,4)24(34)36-16-17(12-27(28,29)30)15-35-20-8-7-18-10-21(37-22(18)11-20)19-6-5-9-33-14-19/h5-11,14,17,23H,12-13,15-16,31-32H2,1-4H3 |
| InChIKey | DGCBRZRZDLLZDZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |