C47H48O10 — CID 146412134
[6-[1,3-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]propan-2-yloxy]-5-hydroxyhexyl] 2-methylprop-2-enoate (PubChem CID 146412134) has the molecular formula C47H48O10 and a molecular weight of 772.89 g/mol. Its IUPAC name is [6-[1,3-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]propan-2-yloxy]-5-hydroxyhexyl] 2-methylprop-2-enoate.
| Compound Name | [6-[1,3-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]propan-2-yloxy]-5-hydroxyhexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146412134 |
| Molecular Formula | C47H48O10 |
| Molecular Weight | 772.89 g/mol |
| Exact Mass | 772.32 |
| IUPAC Name | [6-[1,3-bis[[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy]propan-2-yloxy]-5-hydroxyhexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCC(O)COC(COc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1)COc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1 |
| InChI | InChI=1S/C47H48O10/c1-5-31-13-7-9-16-39(31)41-23-33-18-20-36(25-43(33)56-46(41)50)54-28-38(53-27-35(48)15-11-12-22-52-45(49)30(3)4)29-55-37-21-19-34-24-42(47(51)57-44(34)26-37)40-17-10-8-14-32(40)6-2/h7-10,13-14,16-21,23-26,35,38,48H,3,5-6,11-12,15,22,27-29H2,1-2,4H3 |
| InChIKey | KTGHKRYGGGFXHE-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.89 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|