C50H62O9Si2 — CID 153305926
3-(2-ethylphenyl)-7-[6-[[6-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxyhexyl-methoxy-methylsilyl]oxy-methoxy-methylsilyl]hexoxy]chromen-2-one (PubChem CID 153305926) has the molecular formula C50H62O9Si2 and a molecular weight of 863.21 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-7-[6-[[6-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxyhexyl-methoxy-methylsilyl]oxy-methoxy-methylsilyl]hexoxy]chromen-2-one.
| Compound Name | 3-(2-ethylphenyl)-7-[6-[[6-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxyhexyl-methoxy-methylsilyl]oxy-methoxy-methylsilyl]hexoxy]chromen-2-one |
|---|---|
| PubChem CID | 153305926 |
| Molecular Formula | C50H62O9Si2 |
| Molecular Weight | 863.21 g/mol |
| Exact Mass | 862.39 |
| IUPAC Name | 3-(2-ethylphenyl)-7-[6-[[6-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxyhexyl-methoxy-methylsilyl]oxy-methoxy-methylsilyl]hexoxy]chromen-2-one |
| SMILES | CCc1ccccc1-c1cc2ccc(OCCCCCC[Si](C)(OC)O[Si](C)(CCCCCCOc3ccc4cc(-c5ccccc5CC)c(=O)oc4c3)OC)cc2oc1=O |
| InChI | InChI=1S/C50H62O9Si2/c1-7-37-21-13-15-23-43(37)45-33-39-25-27-41(35-47(39)57-49(45)51)55-29-17-9-11-19-31-60(5,53-3)59-61(6,54-4)32-20-12-10-18-30-56-42-28-26-40-34-46(50(52)58-48(40)36-42)44-24-16-14-22-38(44)8-2/h13-16,21-28,33-36H,7-12,17-20,29-32H2,1-6H3 |
| InChIKey | OBADSGNSLUXRFA-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 106.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.21 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|