C28H35F3O7Si — CID 153305937
7-(6-triethoxysilylhexoxy)-3-[2-(trifluoromethoxy)phenyl]chromen-2-one (PubChem CID 153305937) has the molecular formula C28H35F3O7Si and a molecular weight of 568.66 g/mol. Its IUPAC name is 7-(6-triethoxysilylhexoxy)-3-[2-(trifluoromethoxy)phenyl]chromen-2-one.
| Compound Name | 7-(6-triethoxysilylhexoxy)-3-[2-(trifluoromethoxy)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 153305937 |
| Molecular Formula | C28H35F3O7Si |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 7-(6-triethoxysilylhexoxy)-3-[2-(trifluoromethoxy)phenyl]chromen-2-one |
| SMILES | CCO[Si](CCCCCCOc1ccc2cc(-c3ccccc3OC(F)(F)F)c(=O)oc2c1)(OCC)OCC |
| InChI | InChI=1S/C28H35F3O7Si/c1-4-34-39(35-5-2,36-6-3)18-12-8-7-11-17-33-22-16-15-21-19-24(27(32)37-26(21)20-22)23-13-9-10-14-25(23)38-28(29,30)31/h9-10,13-16,19-20H,4-8,11-12,17-18H2,1-3H3 |
| InChIKey | NECDDSXQYMCWAZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|