C28H38O5Si — CID 153306007
7-[8-[dimethoxy(methyl)silyl]octoxy]-3-(2-ethylphenyl)chromen-2-one (PubChem CID 153306007) has the molecular formula C28H38O5Si and a molecular weight of 482.69 g/mol. Its IUPAC name is 7-[8-[dimethoxy(methyl)silyl]octoxy]-3-(2-ethylphenyl)chromen-2-one.
| Compound Name | 7-[8-[dimethoxy(methyl)silyl]octoxy]-3-(2-ethylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 153306007 |
| Molecular Formula | C28H38O5Si |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 7-[8-[dimethoxy(methyl)silyl]octoxy]-3-(2-ethylphenyl)chromen-2-one |
| SMILES | CCc1ccccc1-c1cc2ccc(OCCCCCCCC[Si](C)(OC)OC)cc2oc1=O |
| InChI | InChI=1S/C28H38O5Si/c1-5-22-14-10-11-15-25(22)26-20-23-16-17-24(21-27(23)33-28(26)29)32-18-12-8-6-7-9-13-19-34(4,30-2)31-3/h10-11,14-17,20-21H,5-9,12-13,18-19H2,1-4H3 |
| InChIKey | GYAIXRMKRLTMBZ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|