C44H44O8 — CID 153454840
7-[4-(ethenoxymethoxy)-7-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxyheptoxy]-3-(2-ethylphenyl)chromen-2-one (PubChem CID 153454840) has the molecular formula C44H44O8 and a molecular weight of 700.83 g/mol. Its IUPAC name is 7-[4-(ethenoxymethoxy)-7-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxyheptoxy]-3-(2-ethylphenyl)chromen-2-one.
| Compound Name | 7-[4-(ethenoxymethoxy)-7-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxyheptoxy]-3-(2-ethylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 153454840 |
| Molecular Formula | C44H44O8 |
| Molecular Weight | 700.83 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | 7-[4-(ethenoxymethoxy)-7-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxyheptoxy]-3-(2-ethylphenyl)chromen-2-one |
| SMILES | C=COCOC(CCCOc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1)CCCOc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1 |
| InChI | InChI=1S/C44H44O8/c1-4-30-13-7-9-17-37(30)39-25-32-19-21-35(27-41(32)51-43(39)45)48-23-11-15-34(50-29-47-6-3)16-12-24-49-36-22-20-33-26-40(44(46)52-42(33)28-36)38-18-10-8-14-31(38)5-2/h6-10,13-14,17-22,25-28,34H,3-5,11-12,15-16,23-24,29H2,1-2H3 |
| InChIKey | GFVUGIMAWDRKFN-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 97.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.83 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|