C53H60O9 — CID 153454794
1,5-bis[[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy]pentan-3-yloxymethyl prop-2-enoate (PubChem CID 153454794) has the molecular formula C53H60O9 and a molecular weight of 841.05 g/mol. Its IUPAC name is 1,5-bis[[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy]pentan-3-yloxymethyl prop-2-enoate.
| Compound Name | 1,5-bis[[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy]pentan-3-yloxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 153454794 |
| Molecular Formula | C53H60O9 |
| Molecular Weight | 841.05 g/mol |
| Exact Mass | 840.42 |
| IUPAC Name | 1,5-bis[[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy]pentan-3-yloxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOC(CCOc1ccc2cc(-c3ccc(CCCCC)cc3CC)c(=O)oc2c1)CCOc1ccc2cc(-c3ccc(CCCCC)cc3CC)c(=O)oc2c1 |
| InChI | InChI=1S/C53H60O9/c1-6-11-13-15-36-17-23-45(38(8-3)29-36)47-31-40-19-21-43(33-49(40)61-52(47)55)57-27-25-42(59-35-60-51(54)10-5)26-28-58-44-22-20-41-32-48(53(56)62-50(41)34-44)46-24-18-37(16-14-12-7-2)30-39(46)9-4/h10,17-24,29-34,42H,5-9,11-16,25-28,35H2,1-4H3 |
| InChIKey | KHLZWWDUXUHDAR-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 114.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.05 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|