C23H22O4S — CID 140898533
[3-(2,4-diethylphenyl)-2-sulfanylidenechromen-7-yl]oxymethyl prop-2-enoate (PubChem CID 140898533) has the molecular formula C23H22O4S and a molecular weight of 394.49 g/mol. Its IUPAC name is [3-(2,4-diethylphenyl)-2-sulfanylidenechromen-7-yl]oxymethyl prop-2-enoate.
| Compound Name | [3-(2,4-diethylphenyl)-2-sulfanylidenechromen-7-yl]oxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 140898533 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [3-(2,4-diethylphenyl)-2-sulfanylidenechromen-7-yl]oxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc2cc(-c3ccc(CC)cc3CC)c(=S)oc2c1 |
| InChI | InChI=1S/C23H22O4S/c1-4-15-7-10-19(16(5-2)11-15)20-12-17-8-9-18(13-21(17)27-23(20)28)25-14-26-22(24)6-3/h6-13H,3-5,14H2,1-2H3 |
| InChIKey | RMJDYYFMUGXIOR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|