C20H20O3S — CID 140898561
3-(2,4-diethylphenyl)-7-(hydroxymethoxy)chromene-2-thione (PubChem CID 140898561) has the molecular formula C20H20O3S and a molecular weight of 340.44 g/mol. Its IUPAC name is 3-(2,4-diethylphenyl)-7-(hydroxymethoxy)chromene-2-thione.
| Compound Name | 3-(2,4-diethylphenyl)-7-(hydroxymethoxy)chromene-2-thione |
|---|---|
| PubChem CID | 140898561 |
| Molecular Formula | C20H20O3S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-(2,4-diethylphenyl)-7-(hydroxymethoxy)chromene-2-thione |
| SMILES | CCc1ccc(-c2cc3ccc(OCO)cc3oc2=S)c(CC)c1 |
| InChI | InChI=1S/C20H20O3S/c1-3-13-5-8-17(14(4-2)9-13)18-10-15-6-7-16(22-12-21)11-19(15)23-20(18)24/h5-11,21H,3-4,12H2,1-2H3 |
| InChIKey | HYXHACDINDNWNY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|