C33H46F2O5Si — CID 153305950
7-[6-[diethoxy(methyl)silyl]-3,4-difluorohexoxy]-3-(2-ethyl-4-pentylphenyl)chromen-2-one (PubChem CID 153305950) has the molecular formula C33H46F2O5Si and a molecular weight of 588.81 g/mol. Its IUPAC name is 7-[6-[diethoxy(methyl)silyl]-3,4-difluorohexoxy]-3-(2-ethyl-4-pentylphenyl)chromen-2-one.
| Compound Name | 7-[6-[diethoxy(methyl)silyl]-3,4-difluorohexoxy]-3-(2-ethyl-4-pentylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 153305950 |
| Molecular Formula | C33H46F2O5Si |
| Molecular Weight | 588.81 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 7-[6-[diethoxy(methyl)silyl]-3,4-difluorohexoxy]-3-(2-ethyl-4-pentylphenyl)chromen-2-one |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCCC(F)C(F)CC[Si](C)(OCC)OCC)cc3oc2=O)c(CC)c1 |
| InChI | InChI=1S/C33H46F2O5Si/c1-6-10-11-12-24-13-16-28(25(7-2)21-24)29-22-26-14-15-27(23-32(26)40-33(29)36)37-19-17-30(34)31(35)18-20-41(5,38-8-3)39-9-4/h13-16,21-23,30-31H,6-12,17-20H2,1-5H3 |
| InChIKey | DHNXPSKCCRQZHG-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.81 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|