C32H40F8O7Si — CID 153306011
7-[8-[diethoxy(methyl)silyl]-3,3,4,4,5,5,6,6-octafluorooctoxy]-3-(3-methoxy-5-pentylfuran-2-yl)chromen-2-one (PubChem CID 153306011) has the molecular formula C32H40F8O7Si and a molecular weight of 716.74 g/mol. Its IUPAC name is 7-[8-[diethoxy(methyl)silyl]-3,3,4,4,5,5,6,6-octafluorooctoxy]-3-(3-methoxy-5-pentylfuran-2-yl)chromen-2-one.
| Compound Name | 7-[8-[diethoxy(methyl)silyl]-3,3,4,4,5,5,6,6-octafluorooctoxy]-3-(3-methoxy-5-pentylfuran-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 153306011 |
| Molecular Formula | C32H40F8O7Si |
| Molecular Weight | 716.74 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | 7-[8-[diethoxy(methyl)silyl]-3,3,4,4,5,5,6,6-octafluorooctoxy]-3-(3-methoxy-5-pentylfuran-2-yl)chromen-2-one |
| SMILES | CCCCCc1cc(OC)c(-c2cc3ccc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](C)(OCC)OCC)cc3oc2=O)o1 |
| InChI | InChI=1S/C32H40F8O7Si/c1-6-9-10-11-23-20-26(42-4)27(46-23)24-18-21-12-13-22(19-25(21)47-28(24)41)43-16-14-29(33,34)31(37,38)32(39,40)30(35,36)15-17-48(5,44-7-2)45-8-3/h12-13,18-20H,6-11,14-17H2,1-5H3 |
| InChIKey | ODPHGGSUZSLQJX-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.74 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|