C28H24F8O6 — CID 157390047
[3,3,4,4,5,5,6,6-octafluoro-8-[3-(4-methoxy-2-methylphenyl)-2-oxochromen-7-yl]oxyoctyl] prop-2-enoate (PubChem CID 157390047) has the molecular formula C28H24F8O6 and a molecular weight of 608.48 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[3-(4-methoxy-2-methylphenyl)-2-oxochromen-7-yl]oxyoctyl] prop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[3-(4-methoxy-2-methylphenyl)-2-oxochromen-7-yl]oxyoctyl] prop-2-enoate |
|---|---|
| PubChem CID | 157390047 |
| Molecular Formula | C28H24F8O6 |
| Molecular Weight | 608.48 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[3-(4-methoxy-2-methylphenyl)-2-oxochromen-7-yl]oxyoctyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(OC)cc3C)c(=O)oc2c1 |
| InChI | InChI=1S/C28H24F8O6/c1-4-23(37)41-12-10-26(31,32)28(35,36)27(33,34)25(29,30)9-11-40-19-6-5-17-14-21(24(38)42-22(17)15-19)20-8-7-18(39-3)13-16(20)2/h4-8,13-15H,1,9-12H2,2-3H3 |
| InChIKey | LODPEQYHRJBKCH-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.48 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|