C27H33NO4 — CID 154029952
[5-hydroxy-6-(2-phenyl-1-propan-2-ylindol-6-yl)oxyhexyl] 2-methylprop-2-enoate (PubChem CID 154029952) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is [5-hydroxy-6-(2-phenyl-1-propan-2-ylindol-6-yl)oxyhexyl] 2-methylprop-2-enoate.
| Compound Name | [5-hydroxy-6-(2-phenyl-1-propan-2-ylindol-6-yl)oxyhexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154029952 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [5-hydroxy-6-(2-phenyl-1-propan-2-ylindol-6-yl)oxyhexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCC(O)COc1ccc2cc(-c3ccccc3)n(C(C)C)c2c1 |
| InChI | InChI=1S/C27H33NO4/c1-19(2)27(30)31-15-9-8-12-23(29)18-32-24-14-13-22-16-25(21-10-6-5-7-11-21)28(20(3)4)26(22)17-24/h5-7,10-11,13-14,16-17,20,23,29H,1,8-9,12,15,18H2,2-4H3 |
| InChIKey | VXQKLXVBYJBKSC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|