C48H48O12 — CID 158810855
[5-hydroxy-6-(2-oxo-3-phenylchromen-7-yl)oxyhexyl] prop-2-enoate;7-hydroxy-3-phenylchromen-2-one;4-(oxiran-2-yl)butyl prop-2-enoate (PubChem CID 158810855) has the molecular formula C48H48O12 and a molecular weight of 816.90 g/mol. Its IUPAC name is [5-hydroxy-6-(2-oxo-3-phenylchromen-7-yl)oxyhexyl] prop-2-enoate;7-hydroxy-3-phenylchromen-2-one;4-(oxiran-2-yl)butyl prop-2-enoate.
| Compound Name | [5-hydroxy-6-(2-oxo-3-phenylchromen-7-yl)oxyhexyl] prop-2-enoate;7-hydroxy-3-phenylchromen-2-one;4-(oxiran-2-yl)butyl prop-2-enoate |
|---|---|
| PubChem CID | 158810855 |
| Molecular Formula | C48H48O12 |
| Molecular Weight | 816.90 g/mol |
| Exact Mass | 816.31 |
| IUPAC Name | [5-hydroxy-6-(2-oxo-3-phenylchromen-7-yl)oxyhexyl] prop-2-enoate;7-hydroxy-3-phenylchromen-2-one;4-(oxiran-2-yl)butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC(O)COc1ccc2cc(-c3ccccc3)c(=O)oc2c1.C=CC(=O)OCCCCC1CO1.O=c1oc2cc(O)ccc2cc1-c1ccccc1 |
| InChI | InChI=1S/C24H24O6.C15H10O3.C9H14O3/c1-2-23(26)28-13-7-6-10-19(25)16-29-20-12-11-18-14-21(17-8-4-3-5-9-17)24(27)30-22(18)15-20;16-12-7-6-11-8-13(10-4-2-1-3-5-10)15(17)18-14(11)9-12;1-2-9(10)11-6-4-3-5-8-7-12-8/h2-5,8-9,11-12,14-15,19,25H,1,6-7,10,13,16H2;1-9,16H;2,8H,1,3-7H2 |
| InChIKey | IUQZWZHUMHIZBC-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 175.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.90 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|