C28H30O9S — CID 151563868
4-[[2-[4-(4-prop-2-enoyloxybutoxysulfonyl)phenyl]-1-benzofuran-6-yl]oxy]butyl prop-2-enoate (PubChem CID 151563868) has the molecular formula C28H30O9S and a molecular weight of 542.61 g/mol. Its IUPAC name is 4-[[2-[4-(4-prop-2-enoyloxybutoxysulfonyl)phenyl]-1-benzofuran-6-yl]oxy]butyl prop-2-enoate.
| Compound Name | 4-[[2-[4-(4-prop-2-enoyloxybutoxysulfonyl)phenyl]-1-benzofuran-6-yl]oxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 151563868 |
| Molecular Formula | C28H30O9S |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 4-[[2-[4-(4-prop-2-enoyloxybutoxysulfonyl)phenyl]-1-benzofuran-6-yl]oxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc2cc(-c3ccc(S(=O)(=O)OCCCCOC(=O)C=C)cc3)oc2c1 |
| InChI | InChI=1S/C28H30O9S/c1-3-27(29)34-16-6-5-15-33-23-12-9-22-19-25(37-26(22)20-23)21-10-13-24(14-11-21)38(31,32)36-18-8-7-17-35-28(30)4-2/h3-4,9-14,19-20H,1-2,5-8,15-18H2 |
| InChIKey | QDACAXQUBVRROS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|