C28H35NO4 — CID 166777155
[4-[[2-(4,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-2,4-dimethylpentan-2-yl] 2-methylprop-2-enoate (PubChem CID 166777155) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is [4-[[2-(4,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-2,4-dimethylpentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [4-[[2-(4,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-2,4-dimethylpentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166777155 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | [4-[[2-(4,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-2,4-dimethylpentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CC(C)(C)Oc1ccc2cc(-c3cnc(CC)cc3CC)oc2c1 |
| InChI | InChI=1S/C28H35NO4/c1-9-19-13-21(10-2)29-16-23(19)25-14-20-11-12-22(15-24(20)31-25)32-27(5,6)17-28(7,8)33-26(30)18(3)4/h11-16H,3,9-10,17H2,1-2,4-8H3 |
| InChIKey | KXRKFWBVQMHFOW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|