C25H28O4S — CID 170412492
[4-[[2-(2-ethylphenyl)-1-benzofuran-6-yl]oxy]-2-methyl-4-sulfanylpentan-2-yl] prop-2-enoate (PubChem CID 170412492) has the molecular formula C25H28O4S and a molecular weight of 424.56 g/mol. Its IUPAC name is [4-[[2-(2-ethylphenyl)-1-benzofuran-6-yl]oxy]-2-methyl-4-sulfanylpentan-2-yl] prop-2-enoate.
| Compound Name | [4-[[2-(2-ethylphenyl)-1-benzofuran-6-yl]oxy]-2-methyl-4-sulfanylpentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 170412492 |
| Molecular Formula | C25H28O4S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [4-[[2-(2-ethylphenyl)-1-benzofuran-6-yl]oxy]-2-methyl-4-sulfanylpentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)(S)Oc1ccc2cc(-c3ccccc3CC)oc2c1 |
| InChI | InChI=1S/C25H28O4S/c1-6-17-10-8-9-11-20(17)22-14-18-12-13-19(15-21(18)27-22)28-25(5,30)16-24(3,4)29-23(26)7-2/h7-15,30H,2,6,16H2,1,3-5H3 |
| InChIKey | IRHIDLJKIMLKNB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 48.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|