C25H25F3O5 — CID 170046982
[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]-2-methylpentan-2-yl] prop-2-enoate (PubChem CID 170046982) has the molecular formula C25H25F3O5 and a molecular weight of 462.46 g/mol. Its IUPAC name is [4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]-2-methylpentan-2-yl] prop-2-enoate.
| Compound Name | [4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]-2-methylpentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 170046982 |
| Molecular Formula | C25H25F3O5 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]-2-methylpentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)Oc1ccc2cc(-c3ccc(OC)cc3C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C25H25F3O5/c1-6-23(29)33-24(3,4)14-15(2)31-18-8-7-16-11-22(32-21(16)13-18)19-10-9-17(30-5)12-20(19)25(26,27)28/h6-13,15H,1,14H2,2-5H3 |
| InChIKey | QMZSZBUFMAZVOY-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|