C28H33F3O4S — CID 170047180
[2-methyl-4-[[2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran-6-yl]oxy]pentan-2-yl] 2-methylprop-2-enoate (PubChem CID 170047180) has the molecular formula C28H33F3O4S and a molecular weight of 522.63 g/mol. Its IUPAC name is [2-methyl-4-[[2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran-6-yl]oxy]pentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-methyl-4-[[2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran-6-yl]oxy]pentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170047180 |
| Molecular Formula | C28H33F3O4S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | [2-methyl-4-[[2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran-6-yl]oxy]pentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CC(C)Oc1ccc2cc(-c3sc(CCCCC)cc3C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C28H33F3O4S/c1-7-8-9-10-21-15-22(28(29,30)31)25(36-21)24-13-19-11-12-20(14-23(19)34-24)33-18(4)16-27(5,6)35-26(32)17(2)3/h11-15,18H,2,7-10,16H2,1,3-6H3 |
| InChIKey | FEWRAQQSOMPSGE-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|