C18H17F3O3S — CID 166777136
2-[5-pentyl-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-ol (PubChem CID 166777136) has the molecular formula C18H17F3O3S and a molecular weight of 370.39 g/mol. Its IUPAC name is 2-[5-pentyl-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-ol.
| Compound Name | 2-[5-pentyl-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 166777136 |
| Molecular Formula | C18H17F3O3S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-[5-pentyl-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-ol |
| SMILES | CCCCCc1cc(OC(F)(F)F)c(-c2cc3ccc(O)cc3o2)s1 |
| InChI | InChI=1S/C18H17F3O3S/c1-2-3-4-5-13-10-16(24-18(19,20)21)17(25-13)15-8-11-6-7-12(22)9-14(11)23-15/h6-10,22H,2-5H2,1H3 |
| InChIKey | JYJNHXPEFPMPDZ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|