C27H33NO3S — CID 166777177
[4-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-2-methylpentan-2-yl] 2-methylprop-2-enoate (PubChem CID 166777177) has the molecular formula C27H33NO3S and a molecular weight of 451.63 g/mol. Its IUPAC name is [4-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-2-methylpentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [4-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-2-methylpentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166777177 |
| Molecular Formula | C27H33NO3S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | [4-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-2-methylpentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CC(C)Sc1ccc2cc(-c3ccc(CC)nc3CC)oc2c1 |
| InChI | InChI=1S/C27H33NO3S/c1-8-20-11-13-22(23(9-2)28-20)25-14-19-10-12-21(15-24(19)30-25)32-18(5)16-27(6,7)31-26(29)17(3)4/h10-15,18H,3,8-9,16H2,1-2,4-7H3 |
| InChIKey | FGGAWOJJRFLHSI-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|