C25H25F3O5 — CID 162608978
[4-[4-(1-benzofuran-2-yl)-3-(trifluoromethoxy)phenoxy]-2,4-dimethylpentan-2-yl] prop-2-enoate (PubChem CID 162608978) has the molecular formula C25H25F3O5 and a molecular weight of 462.46 g/mol. Its IUPAC name is [4-[4-(1-benzofuran-2-yl)-3-(trifluoromethoxy)phenoxy]-2,4-dimethylpentan-2-yl] prop-2-enoate.
| Compound Name | [4-[4-(1-benzofuran-2-yl)-3-(trifluoromethoxy)phenoxy]-2,4-dimethylpentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 162608978 |
| Molecular Formula | C25H25F3O5 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [4-[4-(1-benzofuran-2-yl)-3-(trifluoromethoxy)phenoxy]-2,4-dimethylpentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)(C)Oc1ccc(-c2cc3ccccc3o2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C25H25F3O5/c1-6-22(29)33-24(4,5)15-23(2,3)31-17-11-12-18(21(14-17)32-25(26,27)28)20-13-16-9-7-8-10-19(16)30-20/h6-14H,1,15H2,2-5H3 |
| InChIKey | RZPPZXAYOCHHCS-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|