C23H26F2O4 — CID 163439619
[4-[2,3-difluoro-4-(4-methoxyphenyl)phenoxy]-2,4-dimethylpentan-2-yl] prop-2-enoate (PubChem CID 163439619) has the molecular formula C23H26F2O4 and a molecular weight of 404.45 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(4-methoxyphenyl)phenoxy]-2,4-dimethylpentan-2-yl] prop-2-enoate.
| Compound Name | [4-[2,3-difluoro-4-(4-methoxyphenyl)phenoxy]-2,4-dimethylpentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 163439619 |
| Molecular Formula | C23H26F2O4 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [4-[2,3-difluoro-4-(4-methoxyphenyl)phenoxy]-2,4-dimethylpentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)(C)Oc1ccc(-c2ccc(OC)cc2)c(F)c1F |
| InChI | InChI=1S/C23H26F2O4/c1-7-19(26)29-23(4,5)14-22(2,3)28-18-13-12-17(20(24)21(18)25)15-8-10-16(27-6)11-9-15/h7-13H,1,14H2,2-6H3 |
| InChIKey | AXKDSUVAICWHSN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|