C31H42O6 — CID 166647990
[4-(2,4,4-trimethylpentan-2-yloxy)phenyl] 4-(2,4-dimethyl-4-prop-2-enoyloxypentan-2-yl)oxybenzoate (PubChem CID 166647990) has the molecular formula C31H42O6 and a molecular weight of 510.67 g/mol. Its IUPAC name is [4-(2,4,4-trimethylpentan-2-yloxy)phenyl] 4-(2,4-dimethyl-4-prop-2-enoyloxypentan-2-yl)oxybenzoate.
| Compound Name | [4-(2,4,4-trimethylpentan-2-yloxy)phenyl] 4-(2,4-dimethyl-4-prop-2-enoyloxypentan-2-yl)oxybenzoate |
|---|---|
| PubChem CID | 166647990 |
| Molecular Formula | C31H42O6 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | [4-(2,4,4-trimethylpentan-2-yloxy)phenyl] 4-(2,4-dimethyl-4-prop-2-enoyloxypentan-2-yl)oxybenzoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)(C)Oc1ccc(C(=O)Oc2ccc(OC(C)(C)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H42O6/c1-11-26(32)37-31(9,10)21-30(7,8)36-24-14-12-22(13-15-24)27(33)34-23-16-18-25(19-17-23)35-29(5,6)20-28(2,3)4/h11-19H,1,20-21H2,2-10H3 |
| InChIKey | WHZPMBVYXDTRPA-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|