C31H28O8 — CID 155628433
1-O-[4-(2-methyl-3-prop-2-enoyloxybutan-2-yl)phenyl] 4-O-(4-prop-2-enoyloxyphenyl) benzene-1,4-dicarboxylate (PubChem CID 155628433) has the molecular formula C31H28O8 and a molecular weight of 528.56 g/mol. Its IUPAC name is 1-O-[4-(2-methyl-3-prop-2-enoyloxybutan-2-yl)phenyl] 4-O-(4-prop-2-enoyloxyphenyl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[4-(2-methyl-3-prop-2-enoyloxybutan-2-yl)phenyl] 4-O-(4-prop-2-enoyloxyphenyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 155628433 |
| Molecular Formula | C31H28O8 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 1-O-[4-(2-methyl-3-prop-2-enoyloxybutan-2-yl)phenyl] 4-O-(4-prop-2-enoyloxyphenyl) benzene-1,4-dicarboxylate |
| SMILES | C=CC(=O)Oc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(C(C)(C)C(C)OC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H28O8/c1-6-27(32)36-20(3)31(4,5)23-12-14-25(15-13-23)38-29(34)21-8-10-22(11-9-21)30(35)39-26-18-16-24(17-19-26)37-28(33)7-2/h6-20H,1-2H2,3-5H3 |
| InChIKey | KTJCORRZXRRQDS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|