C23H26O5 — CID 141341856
phenyl 4-(6-prop-2-enoyloxyheptoxy)benzoate (PubChem CID 141341856) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is phenyl 4-(6-prop-2-enoyloxyheptoxy)benzoate.
| Compound Name | phenyl 4-(6-prop-2-enoyloxyheptoxy)benzoate |
|---|---|
| PubChem CID | 141341856 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | phenyl 4-(6-prop-2-enoyloxyheptoxy)benzoate |
| SMILES | C=CC(=O)OC(C)CCCCCOc1ccc(C(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26O5/c1-3-22(24)27-18(2)10-6-5-9-17-26-20-15-13-19(14-16-20)23(25)28-21-11-7-4-8-12-21/h3-4,7-8,11-16,18H,1,5-6,9-10,17H2,2H3 |
| InChIKey | SPNXSDFSLUMMEI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|