C16H24O3 — CID 139665811
2,4,4-trimethylpentan-2-yl 4-methoxybenzoate (PubChem CID 139665811) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yl 4-methoxybenzoate.
| Compound Name | 2,4,4-trimethylpentan-2-yl 4-methoxybenzoate |
|---|---|
| PubChem CID | 139665811 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24O3/c1-15(2,3)11-16(4,5)19-14(17)12-7-9-13(18-6)10-8-12/h7-10H,11H2,1-6H3 |
| InChIKey | QLECPBJWWGFJIH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |