C24H24O4 — CID 146390583
[2,2-dimethyl-3-[(2-phenyl-1-benzofuran-6-yl)oxy]cyclopentyl] prop-2-enoate (PubChem CID 146390583) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is [2,2-dimethyl-3-[(2-phenyl-1-benzofuran-6-yl)oxy]cyclopentyl] prop-2-enoate.
| Compound Name | [2,2-dimethyl-3-[(2-phenyl-1-benzofuran-6-yl)oxy]cyclopentyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390583 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [2,2-dimethyl-3-[(2-phenyl-1-benzofuran-6-yl)oxy]cyclopentyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(Oc2ccc3cc(-c4ccccc4)oc3c2)C1(C)C |
| InChI | InChI=1S/C24H24O4/c1-4-23(25)28-22-13-12-21(24(22,2)3)26-18-11-10-17-14-19(27-20(17)15-18)16-8-6-5-7-9-16/h4-11,14-15,21-22H,1,12-13H2,2-3H3 |
| InChIKey | OAMSOZNCAZYSJT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|