C27H25F3O5 — CID 155262418
[3-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2-methyl-2-(trifluoromethyl)cyclopentyl] prop-2-enoate (PubChem CID 155262418) has the molecular formula C27H25F3O5 and a molecular weight of 486.49 g/mol. Its IUPAC name is [3-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2-methyl-2-(trifluoromethyl)cyclopentyl] prop-2-enoate.
| Compound Name | [3-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2-methyl-2-(trifluoromethyl)cyclopentyl] prop-2-enoate |
|---|---|
| PubChem CID | 155262418 |
| Molecular Formula | C27H25F3O5 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [3-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2-methyl-2-(trifluoromethyl)cyclopentyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(Oc2ccc3cc(-c4ccccc4CC)c(=O)oc3c2)C1(C)C(F)(F)F |
| InChI | InChI=1S/C27H25F3O5/c1-4-16-8-6-7-9-19(16)20-14-17-10-11-18(15-21(17)34-25(20)32)33-22-12-13-23(35-24(31)5-2)26(22,3)27(28,29)30/h5-11,14-15,22-23H,2,4,12-13H2,1,3H3 |
| InChIKey | WQPUVIRIYDCAHA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|