C28H28F3NO5 — CID 155262648
[3-(2-oxo-3-phenylchromen-7-yl)oxy-2-(trifluoromethyl)cyclopentyl] 1,2,3,3-tetramethylaziridine-2-carboxylate (PubChem CID 155262648) has the molecular formula C28H28F3NO5 and a molecular weight of 515.53 g/mol. Its IUPAC name is [3-(2-oxo-3-phenylchromen-7-yl)oxy-2-(trifluoromethyl)cyclopentyl] 1,2,3,3-tetramethylaziridine-2-carboxylate.
| Compound Name | [3-(2-oxo-3-phenylchromen-7-yl)oxy-2-(trifluoromethyl)cyclopentyl] 1,2,3,3-tetramethylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 155262648 |
| Molecular Formula | C28H28F3NO5 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | [3-(2-oxo-3-phenylchromen-7-yl)oxy-2-(trifluoromethyl)cyclopentyl] 1,2,3,3-tetramethylaziridine-2-carboxylate |
| SMILES | CN1C(C)(C)C1(C)C(=O)OC1CCC(Oc2ccc3cc(-c4ccccc4)c(=O)oc3c2)C1C(F)(F)F |
| InChI | InChI=1S/C28H28F3NO5/c1-26(2)27(3,32(26)4)25(34)37-21-13-12-20(23(21)28(29,30)31)35-18-11-10-17-14-19(16-8-6-5-7-9-16)24(33)36-22(17)15-18/h5-11,14-15,20-21,23H,12-13H2,1-4H3 |
| InChIKey | MWSPSXGJFUPWMK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 68.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|