C22H20F3NO3 — CID 70690682
7-(1-methylpiperidin-4-yl)oxy-3-[3-(trifluoromethyl)phenyl]chromen-2-one (PubChem CID 70690682) has the molecular formula C22H20F3NO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is 7-(1-methylpiperidin-4-yl)oxy-3-[3-(trifluoromethyl)phenyl]chromen-2-one.
| Compound Name | 7-(1-methylpiperidin-4-yl)oxy-3-[3-(trifluoromethyl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 70690682 |
| Molecular Formula | C22H20F3NO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 7-(1-methylpiperidin-4-yl)oxy-3-[3-(trifluoromethyl)phenyl]chromen-2-one |
| SMILES | CN1CCC(Oc2ccc3cc(-c4cccc(C(F)(F)F)c4)c(=O)oc3c2)CC1 |
| InChI | InChI=1S/C22H20F3NO3/c1-26-9-7-17(8-10-26)28-18-6-5-15-12-19(21(27)29-20(15)13-18)14-3-2-4-16(11-14)22(23,24)25/h2-6,11-13,17H,7-10H2,1H3 |
| InChIKey | YBRUUAQYHRHEST-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|