C24H22F3NO5S — CID 121155790
6-methyl-4-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidin-4-yl]oxypyran-2-one (PubChem CID 121155790) has the molecular formula C24H22F3NO5S and a molecular weight of 493.50 g/mol. Its IUPAC name is 6-methyl-4-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidin-4-yl]oxypyran-2-one.
| Compound Name | 6-methyl-4-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidin-4-yl]oxypyran-2-one |
|---|---|
| PubChem CID | 121155790 |
| Molecular Formula | C24H22F3NO5S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 6-methyl-4-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidin-4-yl]oxypyran-2-one |
| SMILES | Cc1cc(OC2CCN(S(=O)(=O)c3ccc(-c4cccc(C(F)(F)F)c4)cc3)CC2)cc(=O)o1 |
| InChI | InChI=1S/C24H22F3NO5S/c1-16-13-21(15-23(29)32-16)33-20-9-11-28(12-10-20)34(30,31)22-7-5-17(6-8-22)18-3-2-4-19(14-18)24(25,26)27/h2-8,13-15,20H,9-12H2,1H3 |
| InChIKey | KLXFCBKOPWBOGY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |