C16H14F3NO5S — CID 121155728
6-methyl-4-[1-[4-(trifluoromethyl)phenyl]sulfonylazetidin-3-yl]oxypyran-2-one (PubChem CID 121155728) has the molecular formula C16H14F3NO5S and a molecular weight of 389.35 g/mol. Its IUPAC name is 6-methyl-4-[1-[4-(trifluoromethyl)phenyl]sulfonylazetidin-3-yl]oxypyran-2-one.
| Compound Name | 6-methyl-4-[1-[4-(trifluoromethyl)phenyl]sulfonylazetidin-3-yl]oxypyran-2-one |
|---|---|
| PubChem CID | 121155728 |
| Molecular Formula | C16H14F3NO5S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 6-methyl-4-[1-[4-(trifluoromethyl)phenyl]sulfonylazetidin-3-yl]oxypyran-2-one |
| SMILES | Cc1cc(OC2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)C2)cc(=O)o1 |
| InChI | InChI=1S/C16H14F3NO5S/c1-10-6-12(7-15(21)24-10)25-13-8-20(9-13)26(22,23)14-4-2-11(3-5-14)16(17,18)19/h2-7,13H,8-9H2,1H3 |
| InChIKey | HMVITTCTRUJUOM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |