C18H20FNO5S — CID 90629231
4-[1-[(3-fluorophenyl)methylsulfonyl]piperidin-4-yl]oxy-6-methylpyran-2-one (PubChem CID 90629231) has the molecular formula C18H20FNO5S and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-[1-[(3-fluorophenyl)methylsulfonyl]piperidin-4-yl]oxy-6-methylpyran-2-one.
| Compound Name | 4-[1-[(3-fluorophenyl)methylsulfonyl]piperidin-4-yl]oxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 90629231 |
| Molecular Formula | C18H20FNO5S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 4-[1-[(3-fluorophenyl)methylsulfonyl]piperidin-4-yl]oxy-6-methylpyran-2-one |
| SMILES | Cc1cc(OC2CCN(S(=O)(=O)Cc3cccc(F)c3)CC2)cc(=O)o1 |
| InChI | InChI=1S/C18H20FNO5S/c1-13-9-17(11-18(21)24-13)25-16-5-7-20(8-6-16)26(22,23)12-14-3-2-4-15(19)10-14/h2-4,9-11,16H,5-8,12H2,1H3 |
| InChIKey | QLADUPQTKBCPAQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |