C16H19NO5S2 — CID 90629222
6-methyl-4-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]oxypyran-2-one (PubChem CID 90629222) has the molecular formula C16H19NO5S2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 6-methyl-4-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]oxypyran-2-one.
| Compound Name | 6-methyl-4-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]oxypyran-2-one |
|---|---|
| PubChem CID | 90629222 |
| Molecular Formula | C16H19NO5S2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 6-methyl-4-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]oxypyran-2-one |
| SMILES | Cc1cc(OC2CCN(S(=O)(=O)c3ccc(C)s3)CC2)cc(=O)o1 |
| InChI | InChI=1S/C16H19NO5S2/c1-11-9-14(10-15(18)21-11)22-13-5-7-17(8-6-13)24(19,20)16-4-3-12(2)23-16/h3-4,9-10,13H,5-8H2,1-2H3 |
| InChIKey | ZHSGSENMVLMWGH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |