C22H21NO3 — CID 87521157
7-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-phenylchromen-2-one (PubChem CID 87521157) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 7-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-phenylchromen-2-one.
| Compound Name | 7-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 87521157 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 7-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-phenylchromen-2-one |
| SMILES | O=c1oc2cc(OC3C[C@H]4CC[C@@H](C3)N4)ccc2cc1-c1ccccc1 |
| InChI | InChI=1S/C22H21NO3/c24-22-20(14-4-2-1-3-5-14)10-15-6-9-18(13-21(15)26-22)25-19-11-16-7-8-17(12-19)23-16/h1-6,9-10,13,16-17,19,23H,7-8,11-12H2/t16-,17+,19? |
| InChIKey | UFEDXGAZXMEJCT-JJTKIYQPSA-N |
| XLogP | 4.12 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|