C18H22ClNO3 — CID 56596869
7-(8-azabicyclo[3.2.1]octan-3-yloxy)-3-ethylchromen-2-one;hydrochloride (PubChem CID 56596869) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is 7-(8-azabicyclo[3.2.1]octan-3-yloxy)-3-ethylchromen-2-one;hydrochloride.
| Compound Name | 7-(8-azabicyclo[3.2.1]octan-3-yloxy)-3-ethylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 56596869 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 7-(8-azabicyclo[3.2.1]octan-3-yloxy)-3-ethylchromen-2-one;hydrochloride |
| SMILES | CCc1cc2ccc(OC3CC4CCC(C3)N4)cc2oc1=O.Cl |
| InChI | InChI=1S/C18H21NO3.ClH/c1-2-11-7-12-3-6-15(10-17(12)22-18(11)20)21-16-8-13-4-5-14(9-16)19-13;/h3,6-7,10,13-14,16,19H,2,4-5,8-9H2,1H3;1H |
| InChIKey | ZIYJZSOPVKQFEP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|