About (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride
(1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride (PubChem CID 66721903) has the molecular formula C18H22ClNO2
and a molecular weight of 319.83 g/mol. Its IUPAC name is (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride.
Molecular Properties
| Compound Name | (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride |
| PubChem CID | 66721903 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride |
| SMILES | COc1ccc2cc(OC3C[C@H]4CC[C@@H](C3)N4)ccc2c1.Cl |
| InChI | InChI=1S/C18H21NO2.ClH/c1-20-16-6-2-13-9-17(7-3-12(13)8-16)21-18-10-14-4-5-15(11-18)19-14;/h2-3,6-9,14-15,18-19H,4-5,10-11H2,1H3;1H/t14-,15+,18?; |
| InChIKey | CFXWLHIXMPVUEU-FHNZKSGLSA-N |
| XLogP | 3.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride?
The IUPAC name of (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride (CID 66721903) is (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride.
What is the SMILES notation for (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride?
The canonical SMILES for (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride is COc1ccc2cc(OC3C[C@H]4CC[C@@H](C3)N4)ccc2c1.Cl.
What is the InChIKey of (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride?
The InChIKey is CFXWLHIXMPVUEU-FHNZKSGLSA-N. The full InChI is InChI=1S/C18H21NO2.ClH/c1-20-16-6-2-13-9-17(7-3-12(13)8-16)21-18-10-14-4-5-15(11-18)19-14;/h2-3,6-9,14-15,18-19H,4-5,10-11H2,1H3;1H/t14-,15+,18?;.
What are the key properties of (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride?
(1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride has a molecular weight of 319.83 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-(6-methoxynaphthalen-2-yl)oxy-8-azabicyclo[3.2.1]octane;hydrochloride is sourced from PubChem (CID 66721903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).