About (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane
(1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane (PubChem CID 58878565) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane |
| PubChem CID | 58878565 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane |
| SMILES | COc1cc(OC)cc(OC2C[C@H]3CCC[C@@H](C2)N3)c1 |
| InChI | InChI=1S/C16H23NO3/c1-18-13-8-14(19-2)10-16(9-13)20-15-6-11-4-3-5-12(7-15)17-11/h8-12,15,17H,3-7H2,1-2H3/t11-,12+,15? |
| InChIKey | MOGXWZMNGBHYAS-ODOQXGPZSA-N |
| XLogP | 2.76 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane?
The IUPAC name of (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane (CID 58878565) is (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane.
What is the SMILES notation for (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane?
The canonical SMILES for (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane is COc1cc(OC)cc(OC2C[C@H]3CCC[C@@H](C2)N3)c1.
What is the InChIKey of (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane?
The InChIKey is MOGXWZMNGBHYAS-ODOQXGPZSA-N. The full InChI is InChI=1S/C16H23NO3/c1-18-13-8-14(19-2)10-16(9-13)20-15-6-11-4-3-5-12(7-15)17-11/h8-12,15,17H,3-7H2,1-2H3/t11-,12+,15?.
What are the key properties of (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane?
(1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane has a molecular weight of 277.36 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-(3,5-dimethoxyphenoxy)-9-azabicyclo[3.3.1]nonane is sourced from PubChem (CID 58878565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).