C35H42F3NO5 — CID 155262654
[3-[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy-2-(trifluoromethyl)cyclopentyl] 1,2,3,3-tetramethylaziridine-2-carboxylate (PubChem CID 155262654) has the molecular formula C35H42F3NO5 and a molecular weight of 613.72 g/mol. Its IUPAC name is [3-[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy-2-(trifluoromethyl)cyclopentyl] 1,2,3,3-tetramethylaziridine-2-carboxylate.
| Compound Name | [3-[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy-2-(trifluoromethyl)cyclopentyl] 1,2,3,3-tetramethylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 155262654 |
| Molecular Formula | C35H42F3NO5 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | [3-[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy-2-(trifluoromethyl)cyclopentyl] 1,2,3,3-tetramethylaziridine-2-carboxylate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OC4CCC(OC(=O)C5(C)N(C)C5(C)C)C4C(F)(F)F)cc3oc2=O)c(CC)c1 |
| InChI | InChI=1S/C35H42F3NO5/c1-7-9-10-11-21-12-15-25(22(8-2)18-21)26-19-23-13-14-24(20-29(23)43-31(26)40)42-27-16-17-28(30(27)35(36,37)38)44-32(41)34(5)33(3,4)39(34)6/h12-15,18-20,27-28,30H,7-11,16-17H2,1-6H3 |
| InChIKey | BMZQVERXDHFVFZ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 68.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|