C30H37NO3 — CID 161027694
[2,2-dimethyl-3-(1-pentyl-2-phenylindol-6-yl)oxycyclopentyl] 2-methylprop-2-enoate (PubChem CID 161027694) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is [2,2-dimethyl-3-(1-pentyl-2-phenylindol-6-yl)oxycyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [2,2-dimethyl-3-(1-pentyl-2-phenylindol-6-yl)oxycyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161027694 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | [2,2-dimethyl-3-(1-pentyl-2-phenylindol-6-yl)oxycyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(Oc2ccc3cc(-c4ccccc4)n(CCCCC)c3c2)C1(C)C |
| InChI | InChI=1S/C30H37NO3/c1-6-7-11-18-31-25(22-12-9-8-10-13-22)19-23-14-15-24(20-26(23)31)33-27-16-17-28(30(27,4)5)34-29(32)21(2)3/h8-10,12-15,19-20,27-28H,2,6-7,11,16-18H2,1,3-5H3 |
| InChIKey | XYVOKHKVZTYKJJ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|