hydrogen sulfite;2-phenyl-1-propylindole

C17H18NO3S- — CID 121433978

IUPAChydrogen sulfite;2-phenyl-1-propylindole
SMILESCCCn1c(-c2ccccc2)cc2ccccc21.O=S([O-])O
InChIInChI=1S/C17H17N.H2O3S/c1-2-12-18-16-11-7-6-10-15(16)13-17(18)14-8-4-3-5-9-14;1-4(2)3/h3-11,13H,2,12H2,1H3;(H2,1,2,3)/p-1
InChIKeyQWFHGTMDCRDVBI-UHFFFAOYSA-M
MW316.40 g/mol
LogP4.06
Rot. Bonds3

About hydrogen sulfite;2-phenyl-1-propylindole

hydrogen sulfite;2-phenyl-1-propylindole (PubChem CID 121433978) has the molecular formula C17H18NO3S- and a molecular weight of 316.40 g/mol. Its IUPAC name is hydrogen sulfite;2-phenyl-1-propylindole.

Molecular Properties

Compound Namehydrogen sulfite;2-phenyl-1-propylindole
PubChem CID121433978
Molecular FormulaC17H18NO3S-
Molecular Weight316.40 g/mol
Exact Mass316.10
IUPAC Namehydrogen sulfite;2-phenyl-1-propylindole
SMILESCCCn1c(-c2ccccc2)cc2ccccc21.O=S([O-])O
InChIInChI=1S/C17H17N.H2O3S/c1-2-12-18-16-11-7-6-10-15(16)13-17(18)14-8-4-3-5-9-14;1-4(2)3/h3-11,13H,2,12H2,1H3;(H2,1,2,3)/p-1
InChIKeyQWFHGTMDCRDVBI-UHFFFAOYSA-M
XLogP4.06
TPSA65.29 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.40
LogP ≤ 54.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze hydrogen sulfite;2-phenyl-1-propylindole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen sulfite;2-phenyl-1-propylindole?
The IUPAC name of hydrogen sulfite;2-phenyl-1-propylindole (CID 121433978) is hydrogen sulfite;2-phenyl-1-propylindole.
What is the SMILES notation for hydrogen sulfite;2-phenyl-1-propylindole?
The canonical SMILES for hydrogen sulfite;2-phenyl-1-propylindole is CCCn1c(-c2ccccc2)cc2ccccc21.O=S([O-])O.
What is the InChIKey of hydrogen sulfite;2-phenyl-1-propylindole?
The InChIKey is QWFHGTMDCRDVBI-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H17N.H2O3S/c1-2-12-18-16-11-7-6-10-15(16)13-17(18)14-8-4-3-5-9-14;1-4(2)3/h3-11,13H,2,12H2,1H3;(H2,1,2,3)/p-1.
What are the key properties of hydrogen sulfite;2-phenyl-1-propylindole?
hydrogen sulfite;2-phenyl-1-propylindole has a molecular weight of 316.40 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;2-phenyl-1-propylindole is sourced from PubChem (CID 121433978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).