About hydrogen sulfite;2-phenyl-1-propylindole
hydrogen sulfite;2-phenyl-1-propylindole (PubChem CID 121433978) has the molecular formula C17H18NO3S-
and a molecular weight of 316.40 g/mol. Its IUPAC name is hydrogen sulfite;2-phenyl-1-propylindole.
Molecular Properties
| Compound Name | hydrogen sulfite;2-phenyl-1-propylindole |
| PubChem CID | 121433978 |
| Molecular Formula | C17H18NO3S- |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | hydrogen sulfite;2-phenyl-1-propylindole |
| SMILES | CCCn1c(-c2ccccc2)cc2ccccc21.O=S([O-])O |
| InChI | InChI=1S/C17H17N.H2O3S/c1-2-12-18-16-11-7-6-10-15(16)13-17(18)14-8-4-3-5-9-14;1-4(2)3/h3-11,13H,2,12H2,1H3;(H2,1,2,3)/p-1 |
| InChIKey | QWFHGTMDCRDVBI-UHFFFAOYSA-M |
| XLogP | 4.06 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfite;2-phenyl-1-propylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfite;2-phenyl-1-propylindole?
The IUPAC name of hydrogen sulfite;2-phenyl-1-propylindole (CID 121433978) is hydrogen sulfite;2-phenyl-1-propylindole.
What is the SMILES notation for hydrogen sulfite;2-phenyl-1-propylindole?
The canonical SMILES for hydrogen sulfite;2-phenyl-1-propylindole is CCCn1c(-c2ccccc2)cc2ccccc21.O=S([O-])O.
What is the InChIKey of hydrogen sulfite;2-phenyl-1-propylindole?
The InChIKey is QWFHGTMDCRDVBI-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H17N.H2O3S/c1-2-12-18-16-11-7-6-10-15(16)13-17(18)14-8-4-3-5-9-14;1-4(2)3/h3-11,13H,2,12H2,1H3;(H2,1,2,3)/p-1.
What are the key properties of hydrogen sulfite;2-phenyl-1-propylindole?
hydrogen sulfite;2-phenyl-1-propylindole has a molecular weight of 316.40 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;2-phenyl-1-propylindole is sourced from PubChem (CID 121433978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).