C56H70O5S2 — CID 155236273
[4-[2,8-bis[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-2,4,4,6,6,8-hexamethylnonan-5-yl]oxy-2-methylpentan-2-yl] prop-2-enoate (PubChem CID 155236273) has the molecular formula C56H70O5S2 and a molecular weight of 887.30 g/mol. Its IUPAC name is [4-[2,8-bis[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-2,4,4,6,6,8-hexamethylnonan-5-yl]oxy-2-methylpentan-2-yl] prop-2-enoate.
| Compound Name | [4-[2,8-bis[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-2,4,4,6,6,8-hexamethylnonan-5-yl]oxy-2-methylpentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 155236273 |
| Molecular Formula | C56H70O5S2 |
| Molecular Weight | 887.30 g/mol |
| Exact Mass | 886.47 |
| IUPAC Name | [4-[2,8-bis[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-2,4,4,6,6,8-hexamethylnonan-5-yl]oxy-2-methylpentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)OC(C(C)(C)CC(C)(C)Oc1ccc2cc(-c3ccccc3CC)sc2c1)C(C)(C)CC(C)(C)Oc1ccc2cc(-c3ccccc3CC)sc2c1 |
| InChI | InChI=1S/C56H70O5S2/c1-15-38-22-18-20-24-44(38)48-30-40-26-28-42(32-46(40)62-48)59-55(11,12)35-52(5,6)51(58-37(4)34-54(9,10)61-50(57)17-3)53(7,8)36-56(13,14)60-43-29-27-41-31-49(63-47(41)33-43)45-25-21-19-23-39(45)16-2/h17-33,37,51H,3,15-16,34-36H2,1-2,4-14H3 |
| InChIKey | DCUHXVAYTVVOFM-UHFFFAOYSA-N |
| XLogP | 16.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.30 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|