C25H28N2O5 — CID 138626073
[5-(1,4-diamino-9,10-dioxoanthracen-2-yl)oxy-2,4,4-trimethylpentan-2-yl] prop-2-enoate (PubChem CID 138626073) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is [5-(1,4-diamino-9,10-dioxoanthracen-2-yl)oxy-2,4,4-trimethylpentan-2-yl] prop-2-enoate.
| Compound Name | [5-(1,4-diamino-9,10-dioxoanthracen-2-yl)oxy-2,4,4-trimethylpentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 138626073 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [5-(1,4-diamino-9,10-dioxoanthracen-2-yl)oxy-2,4,4-trimethylpentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)(C)COc1cc(N)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H28N2O5/c1-6-18(28)32-25(4,5)12-24(2,3)13-31-17-11-16(26)19-20(21(17)27)23(30)15-10-8-7-9-14(15)22(19)29/h6-11H,1,12-13,26-27H2,2-5H3 |
| InChIKey | OOWDELKPHWGTTG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|