About (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate
(3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate (PubChem CID 59482865) has the molecular formula C17H22O4
and a molecular weight of 290.36 g/mol. Its IUPAC name is (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate.
Molecular Properties
| Compound Name | (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate |
| PubChem CID | 59482865 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate |
| SMILES | C=CC(=O)OC(C)(C)CCOC(=O)c1ccccc1CC |
| InChI | InChI=1S/C17H22O4/c1-5-13-9-7-8-10-14(13)16(19)20-12-11-17(3,4)21-15(18)6-2/h6-10H,2,5,11-12H2,1,3-4H3 |
| InChIKey | XYNFHOVSESXXHF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate?
The IUPAC name of (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate (CID 59482865) is (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate.
What is the SMILES notation for (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate?
The canonical SMILES for (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate is C=CC(=O)OC(C)(C)CCOC(=O)c1ccccc1CC.
What is the InChIKey of (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate?
The InChIKey is XYNFHOVSESXXHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O4/c1-5-13-9-7-8-10-14(13)16(19)20-12-11-17(3,4)21-15(18)6-2/h6-10H,2,5,11-12H2,1,3-4H3.
What are the key properties of (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate?
(3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate has a molecular weight of 290.36 g/mol, XLogP of 3.30, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-3-prop-2-enoyloxybutyl) 2-ethylbenzoate is sourced from PubChem (CID 59482865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).