C25H28O3S — CID 159919127
[3-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-2,2-dimethylpropyl] 2-methylprop-2-enoate (PubChem CID 159919127) has the molecular formula C25H28O3S and a molecular weight of 408.56 g/mol. Its IUPAC name is [3-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-2,2-dimethylpropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-2,2-dimethylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159919127 |
| Molecular Formula | C25H28O3S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [3-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-2,2-dimethylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)COc1ccc2cc(-c3ccccc3CC)sc2c1 |
| InChI | InChI=1S/C25H28O3S/c1-6-18-9-7-8-10-21(18)23-13-19-11-12-20(14-22(19)29-23)27-15-25(4,5)16-28-24(26)17(2)3/h7-14H,2,6,15-16H2,1,3-5H3 |
| InChIKey | SISKYMHIUKAXSB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|