C27H30F2O3S — CID 146391161
[7-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate (PubChem CID 146391161) has the molecular formula C27H30F2O3S and a molecular weight of 472.60 g/mol. Its IUPAC name is [7-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate.
| Compound Name | [7-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146391161 |
| Molecular Formula | C27H30F2O3S |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | [7-[[2-(2-ethylphenyl)-1-benzothiophen-6-yl]oxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(F)(F)CCCOc1ccc2cc(-c3ccccc3CC)sc2c1 |
| InChI | InChI=1S/C27H30F2O3S/c1-4-20-9-5-6-10-23(20)25-17-21-11-12-22(18-24(21)33-25)31-15-7-13-27(28,29)14-8-16-32-26(30)19(2)3/h5-6,9-12,17-18H,2,4,7-8,13-16H2,1,3H3 |
| InChIKey | NCFGRADXHDEVHQ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|