C25H29NO3S — CID 159919128
[3-[[2-(2,6-diethyl-3-pyridinyl)-1-benzothiophen-6-yl]oxy]-2-methylpropyl] 2-methylprop-2-enoate (PubChem CID 159919128) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is [3-[[2-(2,6-diethyl-3-pyridinyl)-1-benzothiophen-6-yl]oxy]-2-methylpropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[2-(2,6-diethyl-3-pyridinyl)-1-benzothiophen-6-yl]oxy]-2-methylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159919128 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [3-[[2-(2,6-diethyl-3-pyridinyl)-1-benzothiophen-6-yl]oxy]-2-methylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)COc1ccc2cc(-c3ccc(CC)nc3CC)sc2c1 |
| InChI | InChI=1S/C25H29NO3S/c1-6-19-9-11-21(22(7-2)26-19)24-12-18-8-10-20(13-23(18)30-24)28-14-17(5)15-29-25(27)16(3)4/h8-13,17H,3,6-7,14-15H2,1-2,4-5H3 |
| InChIKey | ROKGIHHSARUEHZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|