C31H38F2O3S — CID 146390704
[7-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-4,4-difluoroheptyl] prop-2-enoate (PubChem CID 146390704) has the molecular formula C31H38F2O3S and a molecular weight of 528.71 g/mol. Its IUPAC name is [7-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-4,4-difluoroheptyl] prop-2-enoate.
| Compound Name | [7-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-4,4-difluoroheptyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390704 |
| Molecular Formula | C31H38F2O3S |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | [7-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-4,4-difluoroheptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(F)(F)CCCSc1ccc2cc(-c3ccc(CCCCC)cc3CC)oc2c1 |
| InChI | InChI=1S/C31H38F2O3S/c1-4-7-8-11-23-12-15-27(24(5-2)20-23)29-21-25-13-14-26(22-28(25)36-29)37-19-10-17-31(32,33)16-9-18-35-30(34)6-3/h6,12-15,20-22H,3-5,7-11,16-19H2,1-2H3 |
| InChIKey | STRDSSLQRCPLPE-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|