C24H29NO2S — CID 146390839
S-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]] N,N-dimethylcarbamothioate (PubChem CID 146390839) has the molecular formula C24H29NO2S and a molecular weight of 395.57 g/mol. Its IUPAC name is S-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]] N,N-dimethylcarbamothioate.
| Compound Name | S-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 146390839 |
| Molecular Formula | C24H29NO2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | S-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]] N,N-dimethylcarbamothioate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(SC(=O)N(C)C)cc3o2)c(CC)c1 |
| InChI | InChI=1S/C24H29NO2S/c1-5-7-8-9-17-10-13-21(18(6-2)14-17)23-15-19-11-12-20(16-22(19)27-23)28-24(26)25(3)4/h10-16H,5-9H2,1-4H3 |
| InChIKey | GIEKWWINGXXBGR-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|